 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCC2(O)c3c(NC12C1[NH+]2CC(C(C1)CC2)CC)cccc3 |
| InChI: | InChI=1/C19H26N2O2/c1-2-13-12-21-9-7-14(13)11-17(21)19-18(22,8-10-23-19)15-5-3-4-6-16(15)20-19/h3-6,13-14,17,20,22H,2,7-12H2,1H3/p+1/t13-,14+,17+,18+,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=94.3614 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 315.437 g/mol | logS: -3.22022 | SlogP: 1.4311 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.165411 | Sterimol/B1: 2.40776 | Sterimol/B2: 3.07115 | Sterimol/B3: 4.6766 | |||
| Sterimol/B4: 6.93138 | Sterimol/L: 15.1834 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 534.161 | Positive charged surface: 416.194 | Negative charged surface: 117.967 | Volume: 319.5 | |||
| Hydrophobic surface: 459.382 | Hydrophilic surface: 74.779 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
