Type: Neutral
Formula: C10H16N4O5
SMILES: |
O=C1NC(CC1)C(=O)NC(C(=O)NCC(=O)N)CO |
InChI: |
InChI=1/C10H16N4O5/c11-7(16)3-12-9(18)6(4-15)14-10(19)5-1-2-8(17)13-5/h5-6,15H,1-4H2,(H2,11,16)(H,12,18)(H,13,17)(H,14,19)/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.261 g/mol | logS: -0.4168 | SlogP: -3.6564 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0455355 | Sterimol/B1: 2.23464 | Sterimol/B2: 3.13902 | Sterimol/B3: 3.19726 |
Sterimol/B4: 5.80832 | Sterimol/L: 16.7248 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 503.582 | Positive charged surface: 347.393 | Negative charged surface: 156.189 | Volume: 234.625 |
Hydrophobic surface: 194.31 | Hydrophilic surface: 309.272 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |