Type: Neutral
Formula: C12H16N2O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(\C=C\C)C(=O)NC1=O |
InChI: |
InChI=1/C12H16N2O6/c1-2-3-6-4-14(12(19)13-10(6)18)11-9(17)8(16)7(5-15)20-11/h2-4,7-9,11,15-17H,5H2,1H3,(H,13,18,19)/b3-2+/t7-,8-,9+,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.268 g/mol | logS: -1.02132 | SlogP: -1.5628 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.079404 | Sterimol/B1: 3.5025 | Sterimol/B2: 3.58775 | Sterimol/B3: 4.44996 |
Sterimol/B4: 4.90785 | Sterimol/L: 15.3728 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 493.792 | Positive charged surface: 338.034 | Negative charged surface: 155.758 | Volume: 245.5 |
Hydrophobic surface: 242.639 | Hydrophilic surface: 251.153 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |