Type: Neutral
Formula: C8H8NO8-3
SMILES: |
O=C([O-])C([NH2+]C(CC(=O)[O-])C(=O)[O-])CC(=O)[O-] |
InChI: |
InChI=1/C8H11NO8/c10-5(11)1-3(7(14)15)9-4(8(16)17)2-6(12)13/h3-4,9H,1-2H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/p-3/t3-,4+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 246.151 g/mol | logS: -0.12209 | SlogP: -7.9332 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.320068 | Sterimol/B1: 3.53314 | Sterimol/B2: 3.83546 | Sterimol/B3: 4.5764 |
Sterimol/B4: 4.9796 | Sterimol/L: 11.1087 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 385.823 | Positive charged surface: 143.183 | Negative charged surface: 242.639 | Volume: 183.75 |
Hydrophobic surface: 73.762 | Hydrophilic surface: 312.061 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 0 | Acid groups: 8 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |