Type: Ionized
Formula: C5H8O10P2-2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)C(CC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C5H10O10P2/c6-3(7)1-2(4(8)9)5(16(10,11)12)17(13,14)15/h2,5H,1H2,(H,6,7)(H,8,9)(H2,10,11,12)(H2,13,14,15)/p-2/t2-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 290.057 g/mol | logS: 1.71679 | SlogP: -5.9664 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.208041 | Sterimol/B1: 3.31314 | Sterimol/B2: 3.60998 | Sterimol/B3: 3.8887 |
Sterimol/B4: 5.39413 | Sterimol/L: 10.7622 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 378.379 | Positive charged surface: 129.39 | Negative charged surface: 248.989 | Volume: 185.875 |
Hydrophobic surface: 37.517 | Hydrophilic surface: 340.862 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 4 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|