Type: Neutral
Formula: C9H15N5O4
SMILES: |
O=C1N=C(NC=2NCC(NC1=2)C(O)C(O)CO)N |
InChI: |
InChI=1/C9H15N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h3-4,6,12,15-17H,1-2H2,(H4,10,11,13,14,18)/t3-,4+,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.25 g/mol | logS: -0.10922 | SlogP: -4.1245 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.165998 | Sterimol/B1: 2.16332 | Sterimol/B2: 3.25236 | Sterimol/B3: 3.79528 |
Sterimol/B4: 6.41231 | Sterimol/L: 12.6081 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 434.291 | Positive charged surface: 331.967 | Negative charged surface: 102.324 | Volume: 216.25 |
Hydrophobic surface: 111.384 | Hydrophilic surface: 322.907 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |