 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2C3N(CC(O)(Cc4ccncc4)C(C3)CC)CCc2cc1OC |
| InChI: | InChI=1/C23H30N2O3/c1-4-18-12-20-19-13-22(28-3)21(27-2)11-17(19)7-10-25(20)15-23(18,26)14-16-5-8-24-9-6-16/h5-6,8-9,11,13,18,20,26H,4,7,10,12,14-15H2,1-3H3/t18-,20-,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=134.31 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 382.504 g/mol | logS: -3.17902 | SlogP: 3.49714 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0709315 | Sterimol/B1: 2.36333 | Sterimol/B2: 3.45908 | Sterimol/B3: 3.9346 | |||
| Sterimol/B4: 9.15988 | Sterimol/L: 16.8745 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 640.201 | Positive charged surface: 517.607 | Negative charged surface: 122.594 | Volume: 382.5 | |||
| Hydrophobic surface: 564.833 | Hydrophilic surface: 75.368 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
