Type: Neutral
Formula: C14H19N5O5
SMILES: |
O1C(CCC(OCC)=O)C(O)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C14H19N5O5/c1-2-23-8(20)4-3-7-10(21)11(22)14(24-7)19-6-18-9-12(15)16-5-17-13(9)19/h5-7,10-11,14,21-22H,2-4H2,1H3,(H2,15,16,17)/t7-,10-,11-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.336 g/mol | logS: -1.98429 | SlogP: -0.5335 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.052785 | Sterimol/B1: 3.03123 | Sterimol/B2: 3.1926 | Sterimol/B3: 4.24132 |
Sterimol/B4: 6.08107 | Sterimol/L: 18.1933 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 578.272 | Positive charged surface: 445.334 | Negative charged surface: 132.939 | Volume: 294.25 |
Hydrophobic surface: 277.836 | Hydrophilic surface: 300.436 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |