Type: Neutral
Formula: C12H16N5O5-
SMILES: |
O1C(CO)C(O)C([O-])C1n1c2NC=NC(=O)c2nc1N(C)C |
InChI: |
InChI=1/C12H16N5O5/c1-16(2)12-15-6-9(13-4-14-10(6)21)17(12)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,18-19H,3H2,1-2H3,(H,13,14,21)/q-1/t5-,7+,8-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.29 g/mol | logS: -1.2154 | SlogP: -1.3117 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.197501 | Sterimol/B1: 2.9586 | Sterimol/B2: 3.056 | Sterimol/B3: 5.09571 |
Sterimol/B4: 8.19773 | Sterimol/L: 12.3773 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 491.562 | Positive charged surface: 354.107 | Negative charged surface: 137.456 | Volume: 262.5 |
Hydrophobic surface: 263.271 | Hydrophilic surface: 228.291 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |