Type: Neutral
Formula: C13H19N5O5
SMILES: |
O1C(C(O)CO)C(CCO)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C13H19N5O5/c14-11-8-12(16-4-15-11)18(5-17-8)13-9(22)6(1-2-19)10(23-13)7(21)3-20/h4-7,9-10,13,19-22H,1-3H2,(H2,14,15,16)/t6-,7+,9-,10+,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 325.325 g/mol | logS: -1.03824 | SlogP: -1.8859 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.157173 | Sterimol/B1: 2.38253 | Sterimol/B2: 5.25302 | Sterimol/B3: 5.31093 |
Sterimol/B4: 5.62624 | Sterimol/L: 14.3808 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 533.663 | Positive charged surface: 416.774 | Negative charged surface: 116.889 | Volume: 279.625 |
Hydrophobic surface: 214.065 | Hydrophilic surface: 319.598 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |