Type: Neutral
Formula: C12H17N5O5
SMILES: |
O1C(C(O)CO)C(CO)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C12H17N5O5/c13-10-7-11(15-3-14-10)17(4-16-7)12-8(21)5(1-18)9(22-12)6(20)2-19/h3-6,8-9,12,18-21H,1-2H2,(H2,13,14,15)/t5-,6+,8-,9+,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 311.298 g/mol | logS: -0.83647 | SlogP: -2.276 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0776853 | Sterimol/B1: 2.54107 | Sterimol/B2: 3.68679 | Sterimol/B3: 4.27357 |
Sterimol/B4: 6.16487 | Sterimol/L: 14.0126 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 493.566 | Positive charged surface: 382.123 | Negative charged surface: 111.443 | Volume: 263 |
Hydrophobic surface: 176.49 | Hydrophilic surface: 317.076 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |