Type: Neutral
Formula: C17H19N5O2S
SMILES: |
S(Cc1ccccc1)C1C(O)C(OC1C)n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C17H19N5O2S/c1-10-14(25-7-11-5-3-2-4-6-11)13(23)17(24-10)22-9-21-12-15(18)19-8-20-16(12)22/h2-6,8-10,13-14,17,23H,7H2,1H3,(H2,18,19,20)/t10-,13+,14-,17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 357.438 g/mol | logS: -4.45475 | SlogP: 2.3506 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0534616 | Sterimol/B1: 2.12139 | Sterimol/B2: 3.26115 | Sterimol/B3: 4.2094 |
Sterimol/B4: 8.06727 | Sterimol/L: 18.9737 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 604.468 | Positive charged surface: 400.557 | Negative charged surface: 203.911 | Volume: 326.25 |
Hydrophobic surface: 356.741 | Hydrophilic surface: 247.727 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |