Type: Neutral
Formula: C17H19N5O2S
SMILES: |
S(Cc1ccccc1)C1C(O)C(OC1C)n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C17H19N5O2S/c1-10-14(25-7-11-5-3-2-4-6-11)13(23)17(24-10)22-9-21-12-15(18)19-8-20-16(12)22/h2-6,8-10,13-14,17,23H,7H2,1H3,(H2,18,19,20)/t10-,13-,14-,17+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 357.438 g/mol | logS: -4.45475 | SlogP: 2.3506 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0981932 | Sterimol/B1: 2.05532 | Sterimol/B2: 3.01286 | Sterimol/B3: 5.01342 |
Sterimol/B4: 9.22381 | Sterimol/L: 16.3995 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 597.771 | Positive charged surface: 406.468 | Negative charged surface: 191.303 | Volume: 326 |
Hydrophobic surface: 366.314 | Hydrophilic surface: 231.457 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |