 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CCOC(=O)c2ccccc2)C(O)C(O)C1n1c2nc(nc(N)c2nc1)NC(=O)C |
| InChI: | InChI=1/C20H22N6O6/c1-10(27)23-20-24-16(21)13-17(25-20)26(9-22-13)18-15(29)14(28)12(32-18)7-8-31-19(30)11-5-3-2-4-6-11/h2-6,9,12,14-15,18,28-29H,7-8H2,1H3,(H3,21,23,24,25,27)/t12-,14+,15-,18+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=110.031 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 442.432 g/mol | logS: -4.35425 | SlogP: 0.3287 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0308013 | Sterimol/B1: 2.5646 | Sterimol/B2: 4.90738 | Sterimol/B3: 5.0003 | |||
| Sterimol/B4: 5.86888 | Sterimol/L: 23.3773 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 723.031 | Positive charged surface: 498.563 | Negative charged surface: 224.468 | Volume: 387.75 | |||
| Hydrophobic surface: 425.574 | Hydrophilic surface: 297.457 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.