Type: Neutral
Formula: C13H17N5O3S
SMILES: |
S1C(C2OC(OC2C1n1c2ncnc(N)c2nc1)(C)C)CO |
InChI: |
InChI=1/C13H17N5O3S/c1-13(2)20-8-6(3-19)22-12(9(8)21-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3,(H2,14,15,16)/t6-,8+,9-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.377 g/mol | logS: -3.3615 | SlogP: 0.6304 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.181462 | Sterimol/B1: 2.25285 | Sterimol/B2: 3.9749 | Sterimol/B3: 4.03145 |
Sterimol/B4: 7.76095 | Sterimol/L: 13.475 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 508.8 | Positive charged surface: 372.201 | Negative charged surface: 136.599 | Volume: 279.875 |
Hydrophobic surface: 229.004 | Hydrophilic surface: 279.796 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |