Type: Neutral
Formula: C10H13N5O4S
SMILES: |
S=C1Nc2c(ncnc2N)N1C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C10H13N5O4S/c11-7-4-8(13-2-12-7)15(10(20)14-4)9-6(18)5(17)3(1-16)19-9/h2-3,5-6,9,16-18H,1H2,(H,14,20)(H2,11,12,13)/t3-,5+,6-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.311 g/mol | logS: -1.76499 | SlogP: -1.9854 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.069319 | Sterimol/B1: 2.53547 | Sterimol/B2: 3.27804 | Sterimol/B3: 3.57352 |
Sterimol/B4: 8.34308 | Sterimol/L: 12.8768 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 471.848 | Positive charged surface: 337.253 | Negative charged surface: 134.596 | Volume: 242.125 |
Hydrophobic surface: 123.725 | Hydrophilic surface: 348.123 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |