Type: Neutral
Formula: C17H27N3O2S
SMILES: |
s1c(cnc1NC(=O)CN(C(=O)C(CCCC)CC)CC=C)C |
InChI: |
InChI=1/C17H27N3O2S/c1-5-8-9-14(7-3)16(22)20(10-6-2)12-15(21)19-17-18-11-13(4)23-17/h6,11,14H,2,5,7-10,12H2,1,3-4H3,(H,18,19,21)/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.488 g/mol | logS: -4.40632 | SlogP: 3.62102 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.118907 | Sterimol/B1: 2.54891 | Sterimol/B2: 3.84464 | Sterimol/B3: 5.40412 |
Sterimol/B4: 9.5405 | Sterimol/L: 17.1233 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 644.366 | Positive charged surface: 429.216 | Negative charged surface: 215.151 | Volume: 340.875 |
Hydrophobic surface: 469.054 | Hydrophilic surface: 175.312 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |