Type: Neutral
Formula: C15H18N6O4S2
SMILES: |
S(C)c1nc(SC)nc2n(c3ncnc(N)c3c12)C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C15H18N6O4S2/c1-26-13-7-6-10(16)17-4-18-11(6)21(12(7)19-15(20-13)27-2)14-9(24)8(23)5(3-22)25-14/h4-5,8-9,14,22-24H,3H2,1-2H3,(H2,16,17,18)/t5-,8+,9-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 410.479 g/mol | logS: -5.77528 | SlogP: 0.1075 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.048926 | Sterimol/B1: 2.87826 | Sterimol/B2: 3.91337 | Sterimol/B3: 4.31792 |
Sterimol/B4: 6.74391 | Sterimol/L: 15.0093 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 579.55 | Positive charged surface: 392.138 | Negative charged surface: 176.177 | Volume: 336.25 |
Hydrophobic surface: 263.513 | Hydrophilic surface: 316.037 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |