 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1n1c2NC=NC(=O)c2c2c1ncnc2N |
| InChI: | InChI=1/C13H14N6O5/c14-9-5-6-11(17-3-18-12(6)23)19(10(5)16-2-15-9)13-8(22)7(21)4(1-20)24-13/h2-4,7-8,13,20-22H,1H2,(H2,14,15,16)(H,17,18,23)/t4-,7+,8-,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.404 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 334.292 g/mol | logS: -2.31955 | SlogP: -1.6855 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0808124 | Sterimol/B1: 2.51868 | Sterimol/B2: 3.08737 | Sterimol/B3: 3.65552 | |||
| Sterimol/B4: 8.09735 | Sterimol/L: 12.3623 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 485.747 | Positive charged surface: 361.764 | Negative charged surface: 118.833 | Volume: 268.5 | |||
| Hydrophobic surface: 152.486 | Hydrophilic surface: 333.261 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.