Type: Neutral
Formula: C14H15N5O5
SMILES: |
O1C(CO)C(O)C(O)C1n1cc(c2-c3n(ccn3)C=Nc12)C(=O)N |
InChI: |
InChI=1/C14H15N5O5/c15-11(23)6-3-19(14-10(22)9(21)7(4-20)24-14)13-8(6)12-16-1-2-18(12)5-17-13/h1-3,5,7,9-10,14,20-22H,4H2,(H2,15,23)/t7-,9+,10-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 333.304 g/mol | logS: -1.59069 | SlogP: -1.321 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0588856 | Sterimol/B1: 3.03963 | Sterimol/B2: 3.60583 | Sterimol/B3: 4.86546 |
Sterimol/B4: 5.72135 | Sterimol/L: 14.7025 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 521.573 | Positive charged surface: 374.269 | Negative charged surface: 147.304 | Volume: 280.125 |
Hydrophobic surface: 214.273 | Hydrophilic surface: 307.3 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |