Type: Neutral
Formula: C18H26N2O5
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)NC(C(OC)=O)C |
InChI: |
InChI=1/C18H26N2O5/c1-5-12(2)15(16(21)19-13(3)17(22)24-4)20-18(23)25-11-14-9-7-6-8-10-14/h6-10,12-13,15H,5,11H2,1-4H3,(H,19,21)(H,20,23)/t12-,13-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 350.415 g/mol | logS: -3.76175 | SlogP: 2.2716 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0608726 | Sterimol/B1: 2.46713 | Sterimol/B2: 3.54974 | Sterimol/B3: 5.63976 |
Sterimol/B4: 6.19565 | Sterimol/L: 20.0738 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 647.845 | Positive charged surface: 432.141 | Negative charged surface: 215.705 | Volume: 345 |
Hydrophobic surface: 490.049 | Hydrophilic surface: 157.796 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |