 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C([NH3+])C(CC)C)C(=O)N |
| InChI: | InChI=1/C15H23N3O3/c1-3-9(2)13(16)15(21)18-12(14(17)20)8-10-4-6-11(19)7-5-10/h4-7,9,12-13,19H,3,8,16H2,1-2H3,(H2,17,20)(H,18,21)/p+1/t9-,12+,13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=53.3008 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 294.375 g/mol | logS: -2.42203 | SlogP: -0.43863 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.147078 | Sterimol/B1: 3.51346 | Sterimol/B2: 3.81391 | Sterimol/B3: 4.7154 | |||
| Sterimol/B4: 7.91238 | Sterimol/L: 12.3189 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 530.03 | Positive charged surface: 367.005 | Negative charged surface: 163.024 | Volume: 298.125 | |||
| Hydrophobic surface: 283.113 | Hydrophilic surface: 246.917 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
