 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(C(O)C)C(=O)NC(Cc1ccccc1)C(=O)N |
| InChI: | InChI=1/C21H25N3O5/c1-14(25)18(24-21(28)29-13-16-10-6-3-7-11-16)20(27)23-17(19(22)26)12-15-8-4-2-5-9-15/h2-11,14,17-18,25H,12-13H2,1H3,(H2,22,26)(H,23,27)(H,24,28)/t14-,17+,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=86.202 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 399.447 g/mol | logS: -4.013 | SlogP: 1.14137 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.109695 | Sterimol/B1: 2.20629 | Sterimol/B2: 3.17519 | Sterimol/B3: 6.85051 | |||
| Sterimol/B4: 8.34137 | Sterimol/L: 17.5895 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 695.39 | Positive charged surface: 425.27 | Negative charged surface: 270.119 | Volume: 378.375 | |||
| Hydrophobic surface: 480.991 | Hydrophilic surface: 214.399 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.