Type: Neutral
Formula: C23H23N3O3S
SMILES: |
s1ccnc1NC(=O)CN(C(=O)c1ccc(cc1)-c1ccccc1)CC1OCCC1 |
InChI: |
InChI=1/C23H23N3O3S/c27-21(25-23-24-12-14-30-23)16-26(15-20-7-4-13-29-20)22(28)19-10-8-18(9-11-19)17-5-2-1-3-6-17/h1-3,5-6,8-12,14,20H,4,7,13,15-16H2,(H,24,25,27)/t20-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 421.521 g/mol | logS: -6.01422 | SlogP: 4.07 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.063919 | Sterimol/B1: 3.60097 | Sterimol/B2: 3.60481 | Sterimol/B3: 4.66702 |
Sterimol/B4: 10.1381 | Sterimol/L: 18.1036 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 700.262 | Positive charged surface: 420.845 | Negative charged surface: 268.878 | Volume: 397.25 |
Hydrophobic surface: 605.361 | Hydrophilic surface: 94.901 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |