 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C(CC)C)C(=O)N)C(N)Cc1ccccc1 |
| InChI: | InChI=1/C15H23N3O2/c1-3-10(2)13(14(17)19)18-15(20)12(16)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H2,17,19)(H,18,20)/t10-,12+,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=74.2204 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 277.368 g/mol | logS: -2.80837 | SlogP: 0.57257 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.102629 | Sterimol/B1: 2.19076 | Sterimol/B2: 3.12326 | Sterimol/B3: 4.6324 | |||
| Sterimol/B4: 7.09898 | Sterimol/L: 15.2096 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 533.02 | Positive charged surface: 337.784 | Negative charged surface: 195.235 | Volume: 286.125 | |||
| Hydrophobic surface: 338.121 | Hydrophilic surface: 194.899 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
