Type: Neutral
Formula: C16H23N3O4
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(C)C)C(=O)NC(C(=O)N)C |
InChI: |
InChI=1/C16H23N3O4/c1-10(2)13(15(21)18-11(3)14(17)20)19-16(22)23-9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3,(H2,17,20)(H,18,21)(H,19,22)/t11-,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 321.377 g/mol | logS: -3.11692 | SlogP: 1.1938 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0546961 | Sterimol/B1: 2.0466 | Sterimol/B2: 3.14297 | Sterimol/B3: 4.9505 |
Sterimol/B4: 7.09953 | Sterimol/L: 18.6399 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 602.996 | Positive charged surface: 380.37 | Negative charged surface: 222.626 | Volume: 312.25 |
Hydrophobic surface: 371.332 | Hydrophilic surface: 231.664 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |