Type: Neutral
Formula: C17H24N2O2
SMILES: |
O=C(NC1CCCCC1C)C(=O)NCCc1ccccc1 |
InChI: |
InChI=1/C17H24N2O2/c1-13-7-5-6-10-15(13)19-17(21)16(20)18-12-11-14-8-3-2-4-9-14/h2-4,8-9,13,15H,5-7,10-12H2,1H3,(H,18,20)(H,19,21)/t13-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.391 g/mol | logS: -3.43796 | SlogP: 2.04017 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0322089 | Sterimol/B1: 2.18659 | Sterimol/B2: 2.90905 | Sterimol/B3: 3.53121 |
Sterimol/B4: 6.61257 | Sterimol/L: 18.9511 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 580.556 | Positive charged surface: 390.253 | Negative charged surface: 190.303 | Volume: 298.75 |
Hydrophobic surface: 470.402 | Hydrophilic surface: 110.154 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |