Type: Neutral
Formula: C16H26N2O2S
SMILES: |
s1cccc1CNC(=O)CCC(=O)NC(CCCCC)C |
InChI: |
InChI=1/C16H26N2O2S/c1-3-4-5-7-13(2)18-16(20)10-9-15(19)17-12-14-8-6-11-21-14/h6,8,11,13H,3-5,7,9-10,12H2,1-2H3,(H,17,19)(H,18,20)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.462 g/mol | logS: -3.67594 | SlogP: 3.4959 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0323292 | Sterimol/B1: 2.54429 | Sterimol/B2: 3.29635 | Sterimol/B3: 3.56001 |
Sterimol/B4: 8.18983 | Sterimol/L: 20.5445 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 641.272 | Positive charged surface: 427.491 | Negative charged surface: 213.781 | Volume: 319.625 |
Hydrophobic surface: 508.687 | Hydrophilic surface: 132.585 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |