Type: Neutral
Formula: C10H14N2O6
SMILES: |
O1C(CO)C(OC)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O6/c1-17-8-5(4-13)18-9(7(8)15)12-3-2-6(14)11-10(12)16/h2-3,5,7-9,13,15H,4H2,1H3,(H,11,14,16)/t5-,7+,8+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.23 g/mol | logS: -0.21683 | SlogP: -1.855 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.142231 | Sterimol/B1: 2.31135 | Sterimol/B2: 2.54355 | Sterimol/B3: 4.75999 |
Sterimol/B4: 6.93568 | Sterimol/L: 12.4034 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 439.721 | Positive charged surface: 310.692 | Negative charged surface: 129.029 | Volume: 217 |
Hydrophobic surface: 240.722 | Hydrophilic surface: 198.999 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |