Type: Ionized
Formula: C9H16NO7-
SMILES: |
O(C(C(N)C=O)C(O)C(O)CO)C(C(=O)[O-])C |
InChI: |
InChI=1/C9H17NO7/c1-4(9(15)16)17-8(5(10)2-11)7(14)6(13)3-12/h2,4-8,12-14H,3,10H2,1H3,(H,15,16)/p-1/t4-,5+,6+,7+,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 250.227 g/mol | logS: 0.56703 | SlogP: -4.2497 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.181417 | Sterimol/B1: 2.90053 | Sterimol/B2: 3.19644 | Sterimol/B3: 4.22014 |
Sterimol/B4: 7.65844 | Sterimol/L: 11.7549 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 433.912 | Positive charged surface: 273.935 | Negative charged surface: 159.977 | Volume: 216.875 |
Hydrophobic surface: 145.302 | Hydrophilic surface: 288.61 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|