Type: Neutral
Formula: C20H34N2O2
SMILES: |
O=C(NC1CCCC(C)C1C)CCC(=O)NCCC=1CCCCC=1 |
InChI: |
InChI=1/C20H34N2O2/c1-15-7-6-10-18(16(15)2)22-20(24)12-11-19(23)21-14-13-17-8-4-3-5-9-17/h8,15-16,18H,3-7,9-14H2,1-2H3,(H,21,23)(H,22,24)/t15-,16+,18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.504 g/mol | logS: -3.855 | SlogP: 3.7142 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0411317 | Sterimol/B1: 2.56349 | Sterimol/B2: 2.73524 | Sterimol/B3: 5.04297 |
Sterimol/B4: 5.86273 | Sterimol/L: 20.7935 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 664.111 | Positive charged surface: 505.702 | Negative charged surface: 158.409 | Volume: 360.875 |
Hydrophobic surface: 535.89 | Hydrophilic surface: 128.221 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |