Type: Ionized
Formula: C6H8O10P-3
SMILES: |
P(OC1OC(C(=O)[O-])C(O)C(O)C1O)(=O)([O-])[O-] |
InChI: |
InChI=1/C6H11O10P/c7-1-2(8)4(5(10)11)15-6(3(1)9)16-17(12,13)14/h1-4,6-9H,(H,10,11)(H2,12,13,14)/p-3/t1-,2-,3+,4+,6+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 271.094 g/mol | logS: 0.8605 | SlogP: -6.681 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.247339 | Sterimol/B1: 2.48343 | Sterimol/B2: 3.18981 | Sterimol/B3: 3.88336 |
Sterimol/B4: 5.95619 | Sterimol/L: 11.8518 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 385.106 | Positive charged surface: 142.21 | Negative charged surface: 242.896 | Volume: 179.875 |
Hydrophobic surface: 62.6763 | Hydrophilic surface: 322.4297 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 5 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|