Type: Ionized
Formula: C6H12NO8P-2
SMILES: |
P(OCC(O)C(O)C(O)C(N)C=O)(=O)([O-])[O-] |
InChI: |
InChI=1/C6H14NO8P/c7-3(1-8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,9-11H,2,7H2,(H2,12,13,14)/p-2/t3-,4-,5-,6+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.135 g/mol | logS: 1.56509 | SlogP: -5.6296 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.10023 | Sterimol/B1: 2.71752 | Sterimol/B2: 2.7895 | Sterimol/B3: 3.58986 |
Sterimol/B4: 4.0948 | Sterimol/L: 12.961 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 410.739 | Positive charged surface: 204.747 | Negative charged surface: 205.992 | Volume: 190.875 |
Hydrophobic surface: 97.2719 | Hydrophilic surface: 313.4671 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|