Type: Ionized
Formula: C9H16NO8-
SMILES: |
OC(C(N)C(O)CC(=O)C(=O)[O-])C(O)C(O)CO |
InChI: |
InChI=1/C9H17NO8/c10-6(3(12)1-4(13)9(17)18)8(16)7(15)5(14)2-11/h3,5-8,11-12,14-16H,1-2,10H2,(H,17,18)/p-1/t3-,5-,6-,7-,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.226 g/mol | logS: 1.26124 | SlogP: -5.5413 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0899911 | Sterimol/B1: 3.24833 | Sterimol/B2: 3.36121 | Sterimol/B3: 3.56027 |
Sterimol/B4: 3.90539 | Sterimol/L: 15.5839 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 451.071 | Positive charged surface: 267.808 | Negative charged surface: 183.263 | Volume: 220.125 |
Hydrophobic surface: 127.655 | Hydrophilic surface: 323.416 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|