Type: Neutral
Formula: C9H17NO8
SMILES: |
OC(C(N)C(O)CC(=O)C(O)=O)C(O)C(O)CO |
InChI: |
InChI=1/C9H17NO8/c10-6(3(12)1-4(13)9(17)18)8(16)7(15)5(14)2-11/h3,5-8,11-12,14-16H,1-2,10H2,(H,17,18)/t3-,5+,6+,7+,8-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.234 g/mol | logS: 1.52169 | SlogP: -4.2066 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0649264 | Sterimol/B1: 3.19732 | Sterimol/B2: 3.33205 | Sterimol/B3: 3.3784 |
Sterimol/B4: 3.80208 | Sterimol/L: 16.6447 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 458.349 | Positive charged surface: 302.383 | Negative charged surface: 155.965 | Volume: 221.875 |
Hydrophobic surface: 119.828 | Hydrophilic surface: 338.521 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |