Type: Ionized
Formula: C9H16NO8-
SMILES: |
OC(C(N)C(O)CC(=O)C(=O)[O-])C(O)C(O)CO |
InChI: |
InChI=1/C9H17NO8/c10-6(3(12)1-4(13)9(17)18)8(16)7(15)5(14)2-11/h3,5-8,11-12,14-16H,1-2,10H2,(H,17,18)/p-1/t3-,5+,6-,7+,8-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.226 g/mol | logS: 1.26124 | SlogP: -5.5413 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0447569 | Sterimol/B1: 2.57562 | Sterimol/B2: 3.27329 | Sterimol/B3: 3.66462 |
Sterimol/B4: 3.72407 | Sterimol/L: 15.8748 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 442.963 | Positive charged surface: 268.53 | Negative charged surface: 174.433 | Volume: 216.5 |
Hydrophobic surface: 139.871 | Hydrophilic surface: 303.092 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|