Type: Neutral
Formula: C15H18N4O3
| SMILES: |
OC(=O)C(NC(=O)C(N)Cc1[nH]cnc1)Cc1ccccc1 |
| InChI: |
InChI=1/C15H18N4O3/c16-12(7-11-8-17-9-18-11)14(20)19-13(15(21)22)6-10-4-2-1-3-5-10/h1-5,8-9,12-13H,6-7,16H2,(H,17,18)(H,19,20)(H,21,22)/t12-,13-/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 302.334 g/mol | logS: -1.86619 | SlogP: 0.09154 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.115721 | Sterimol/B1: 2.48912 | Sterimol/B2: 3.74054 | Sterimol/B3: 3.96058 |
| Sterimol/B4: 9.07884 | Sterimol/L: 15.1367 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 546.074 | Positive charged surface: 368.901 | Negative charged surface: 177.174 | Volume: 285.75 |
| Hydrophobic surface: 345.342 | Hydrophilic surface: 200.732 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |