 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(OC(OC2)c2ccccc2)C([NH3+])C(NC(=O)c2ccccc2)C1OC |
| InChI: | InChI=1/C21H24N2O5/c1-25-21-17(23-19(24)13-8-4-2-5-9-13)16(22)18-15(27-21)12-26-20(28-18)14-10-6-3-7-11-14/h2-11,15-18,20-21H,12,22H2,1H3,(H,23,24)/p+1/t15-,16-,17-,18-,20-,21+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=73.7823 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 385.44 g/mol | logS: -3.59558 | SlogP: 0.9765 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0922795 | Sterimol/B1: 2.01429 | Sterimol/B2: 3.51129 | Sterimol/B3: 4.69343 | |||
| Sterimol/B4: 8.17789 | Sterimol/L: 18.7369 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 656.173 | Positive charged surface: 446.303 | Negative charged surface: 209.87 | Volume: 368 | |||
| Hydrophobic surface: 560.044 | Hydrophilic surface: 96.129 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
