Type: Neutral
Formula: C14H17NO5
SMILES: |
O1C(OC)C(NC(=O)c2ccccc2)C2OC2C1CO |
InChI: |
InChI=1/C14H17NO5/c1-18-14-10(12-11(20-12)9(7-16)19-14)15-13(17)8-5-3-2-4-6-8/h2-6,9-12,14,16H,7H2,1H3,(H,15,17)/t9-,10+,11-,12+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 279.292 g/mol | logS: -1.9348 | SlogP: -0.084 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.175946 | Sterimol/B1: 2.14862 | Sterimol/B2: 3.07428 | Sterimol/B3: 5.47157 |
Sterimol/B4: 7.34046 | Sterimol/L: 13.2664 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 508.202 | Positive charged surface: 344.083 | Negative charged surface: 164.119 | Volume: 259 |
Hydrophobic surface: 402.769 | Hydrophilic surface: 105.433 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |