Type: Ionized
Formula: C8H14NO8-
SMILES: |
OC(C(O)C(O)CO)C(O)C(=O)NCC(=O)[O-] |
InChI: |
InChI=1/C8H15NO8/c10-2-3(11)5(14)6(15)7(16)8(17)9-1-4(12)13/h3,5-7,10-11,14-16H,1-2H2,(H,9,17)(H,12,13)/p-1/t3-,5-,6+,7+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 252.199 g/mol | logS: 0.9933 | SlogP: -5.7116 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0779978 | Sterimol/B1: 3.21436 | Sterimol/B2: 3.56664 | Sterimol/B3: 3.56714 |
Sterimol/B4: 4.64712 | Sterimol/L: 15.1671 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 442.784 | Positive charged surface: 271.357 | Negative charged surface: 171.427 | Volume: 203.625 |
Hydrophobic surface: 132.225 | Hydrophilic surface: 310.559 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|