Type: Ionized
Formula: C9H15O9-
SMILES: |
O1C(C(O)C(O)CO)C(O)C(O)CC1(O)C(=O)[O-] |
InChI: |
InChI=1/C9H16O9/c10-2-4(12)6(14)7-5(13)3(11)1-9(17,18-7)8(15)16/h3-7,10-14,17H,1-2H2,(H,15,16)/p-1/t3-,4+,5+,6+,7+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.21 g/mol | logS: 0.8192 | SlogP: -5.3503 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.140186 | Sterimol/B1: 2.96557 | Sterimol/B2: 4.36559 | Sterimol/B3: 4.79646 |
Sterimol/B4: 4.88373 | Sterimol/L: 12.5961 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 429.074 | Positive charged surface: 266.034 | Negative charged surface: 163.04 | Volume: 212.5 |
Hydrophobic surface: 124.724 | Hydrophilic surface: 304.35 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Parent related molecule:
|