 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(=O)N |
| InChI: | InChI=1/C10H15N6O6P/c11-8-5-9(14-2-13-8)16(3-15-5)10-7(18)6(17)4(22-10)1-21-23(12,19)20/h2-4,6-7,10,17-18H,1H2,(H2,11,13,14)(H3,12,19,20)/t4-,6+,7-,10+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=32.546 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 346.24 g/mol | logS: -0.9268 | SlogP: -2.8713 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0675858 | Sterimol/B1: 2.62956 | Sterimol/B2: 4.16812 | Sterimol/B3: 4.59408 | |||
| Sterimol/B4: 5.1302 | Sterimol/L: 15.1935 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 540.492 | Positive charged surface: 390.261 | Negative charged surface: 150.231 | Volume: 268.875 | |||
| Hydrophobic surface: 135.788 | Hydrophilic surface: 404.704 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.