Type: Neutral
Formula: C6H14NO8P
SMILES: |
P(OCC1OC(O)(CO)C(N)C1O)(O)(O)=O |
InChI: |
InChI=1/C6H14NO8P/c7-5-4(9)3(1-14-16(11,12)13)15-6(5,10)2-8/h3-5,8-10H,1-2,7H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 259.151 g/mol | logS: 1.39324 | SlogP: -4.2066 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.102502 | Sterimol/B1: 3.33382 | Sterimol/B2: 3.42723 | Sterimol/B3: 3.82657 |
Sterimol/B4: 5.5067 | Sterimol/L: 12.2231 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 444.094 | Positive charged surface: 294.665 | Negative charged surface: 149.429 | Volume: 195 |
Hydrophobic surface: 102.406 | Hydrophilic surface: 341.688 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|