Type: Ionized
Formula: C3H3O9PS-4
SMILES: |
S(=O)(=O)([O-])CC(OP(=O)([O-])[O-])C(=O)[O-] |
InChI: |
InChI=1/C3H7O9PS/c4-3(5)2(1-14(9,10)11)12-13(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H,9,10,11)/p-4/t2-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 246.088 g/mol | logS: 0.33302 | SlogP: -5.5748 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.201984 | Sterimol/B1: 2.56365 | Sterimol/B2: 3.23148 | Sterimol/B3: 4.03665 |
Sterimol/B4: 4.99458 | Sterimol/L: 10.4418 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 351.232 | Positive charged surface: 56.1439 | Negative charged surface: 295.088 | Volume: 145.625 |
Hydrophobic surface: 32.1357 | Hydrophilic surface: 319.0963 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 8 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|