Type: Neutral
Formula: C3H7O9PS
SMILES: |
S(O)(=O)(=O)CC(OP(O)(O)=O)C(O)=O |
InChI: |
InChI=1/C3H7O9PS/c4-3(5)2(1-14(9,10)11)12-13(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H,9,10,11)/t2-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 250.12 g/mol | logS: 0.80803 | SlogP: -3.1992 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.143866 | Sterimol/B1: 2.55493 | Sterimol/B2: 3.58049 | Sterimol/B3: 4.40302 |
Sterimol/B4: 5.30194 | Sterimol/L: 10.0343 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 366.905 | Positive charged surface: 163.213 | Negative charged surface: 203.693 | Volume: 155.875 |
Hydrophobic surface: 46.2848 | Hydrophilic surface: 320.6202 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|