 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(NC(=O)C(NC(=O)C)CC(C)C)CC(C)C)C(=O)N |
| InChI: | InChI=1/C23H36N4O5/c1-13(2)10-19(25-15(5)28)22(31)27-20(11-14(3)4)23(32)26-18(21(24)30)12-16-6-8-17(29)9-7-16/h6-9,13-14,18-20,29H,10-12H2,1-5H3,(H2,24,30)(H,25,28)(H,26,32)(H,27,31)/t18-,19-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=118.395 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 448.564 g/mol | logS: -4.98043 | SlogP: 0.98647 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.236235 | Sterimol/B1: 3.84729 | Sterimol/B2: 3.84917 | Sterimol/B3: 6.16762 | |||
| Sterimol/B4: 9.61452 | Sterimol/L: 15.3036 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 771.719 | Positive charged surface: 507.889 | Negative charged surface: 263.83 | Volume: 443.75 | |||
| Hydrophobic surface: 480.91 | Hydrophilic surface: 290.809 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.