Type: Neutral
Formula: C16H27NO11
SMILES: |
O1C(CO)C(O)C(O)C(O)C1OCC1OC(OC(C#N)(C)C)C(O)C(O)C1O |
InChI: |
InChI=1/C16H27NO11/c1-16(2,5-17)28-15-13(24)11(22)9(20)7(27-15)4-25-14-12(23)10(21)8(19)6(3-18)26-14/h6-15,18-24H,3-4H2,1-2H3/t6-,7-,8-,9-,10+,11+,12-,13-,14-,15+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 409.388 g/mol | logS: 0.16575 | SlogP: -4.07072 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0514002 | Sterimol/B1: 1.969 | Sterimol/B2: 3.49728 | Sterimol/B3: 4.66607 |
Sterimol/B4: 8.08696 | Sterimol/L: 15.3039 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 628.72 | Positive charged surface: 460.436 | Negative charged surface: 168.284 | Volume: 348 |
Hydrophobic surface: 281.756 | Hydrophilic surface: 346.964 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 12 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 10 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |