Type: Neutral
Formula: C14H23N3O6
SMILES: |
O1C2N(CC1CC(O)C(NC(=O)C(N)C(C)C)C(O)=O)C(=O)C2 |
InChI: |
InChI=1/C14H23N3O6/c1-6(2)11(15)13(20)16-12(14(21)22)8(18)3-7-5-17-9(19)4-10(17)23-7/h6-8,10-12,18H,3-5,15H2,1-2H3,(H,16,20)(H,21,22)/t7-,8-,10-,11-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.353 g/mol | logS: -0.44984 | SlogP: -1.7527 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0870801 | Sterimol/B1: 2.30991 | Sterimol/B2: 4.26258 | Sterimol/B3: 5.28894 |
Sterimol/B4: 5.66502 | Sterimol/L: 16.6903 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 561.155 | Positive charged surface: 344.314 | Negative charged surface: 157.434 | Volume: 297.375 |
Hydrophobic surface: 270.939 | Hydrophilic surface: 290.216 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |