 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3cc(C)c(cc3nc2)C)C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C14H18N2O7P/c1-7-3-9-10(4-8(7)2)16(6-15-9)14-13(18)12(17)11(23-14)5-22-24(19,20)21/h3-4,6,11-14,17H,5H2,1-2H3,(H2,19,20,21)/q-1/p-2/t11-,12-,13-,14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=63.0028 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 355.263 g/mol | logS: -2.21316 | SlogP: -1.41886 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.034212 | Sterimol/B1: 2.99854 | Sterimol/B2: 3.26095 | Sterimol/B3: 3.30846 | |||
| Sterimol/B4: 6.34832 | Sterimol/L: 16.3211 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 550.781 | Positive charged surface: 263.493 | Negative charged surface: 287.288 | Volume: 292.75 | |||
| Hydrophobic surface: 312.14 | Hydrophilic surface: 238.641 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
