Type: Neutral
Formula: C9H17NO6S
SMILES: |
S(CC1OC(O)C(O)C1O)CCC(N)C(O)=O |
InChI: |
InChI=1/C9H17NO6S/c10-4(8(13)14)1-2-17-3-5-6(11)7(12)9(15)16-5/h4-7,9,11-12,15H,1-3,10H2,(H,13,14)/t4-,5+,6+,7+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 267.302 g/mol | logS: -0.03598 | SlogP: -2.0394 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0339207 | Sterimol/B1: 2.60946 | Sterimol/B2: 3.26613 | Sterimol/B3: 4.2045 |
Sterimol/B4: 4.34001 | Sterimol/L: 15.8303 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 494.479 | Positive charged surface: 347.134 | Negative charged surface: 147.345 | Volume: 226.875 |
Hydrophobic surface: 168.479 | Hydrophilic surface: 326 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |